C22H26N6O4 — CID 163635326
(3S)-3-[(3S,4aS,5R,6S,8aR)-6-hydroxy-2-isocyano-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]-3-(2-azidoethyl)-1H-indol-2-one;carbon dioxide (PubChem CID 163635326) has the molecular formula C22H26N6O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is (3S)-3-[(3S,4aS,5R,6S,8aR)-6-hydroxy-2-isocyano-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]-3-(2-azidoethyl)-1H-indol-2-one;carbon dioxide.
| Compound Name | (3S)-3-[(3S,4aS,5R,6S,8aR)-6-hydroxy-2-isocyano-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]-3-(2-azidoethyl)-1H-indol-2-one;carbon dioxide |
|---|---|
| PubChem CID | 163635326 |
| Molecular Formula | C22H26N6O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (3S)-3-[(3S,4aS,5R,6S,8aR)-6-hydroxy-2-isocyano-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]-3-(2-azidoethyl)-1H-indol-2-one;carbon dioxide |
| SMILES | O=C=O.[C-]#[N+]N1C[C@@H]2CC[C@H](O)[C@H](C)[C@H]2C[C@H]1[C@@]1(CCN=[N+]=[N-])C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C21H26N6O2.CO2/c1-13-15-11-19(27(23-2)12-14(15)7-8-18(13)28)21(9-10-24-26-22)16-5-3-4-6-17(16)25-20(21)29;2-1-3/h3-6,13-15,18-19,28H,7-12H2,1H3,(H,25,29);/t13-,14+,15-,18+,19+,21+;/m1./s1 |
| InChIKey | HZPBWQZQWMHUJY-DSWXEHFQSA-N |
| XLogP | 2.93 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|