C25H21N5O — CID 163636759
[2-[4-(1-aminocyclobutyl)phenyl]-8-cyano-3-phenylimidazo[1,2-a]pyridin-7-yl] methanimidate (PubChem CID 163636759) has the molecular formula C25H21N5O and a molecular weight of 407.48 g/mol. Its IUPAC name is [2-[4-(1-aminocyclobutyl)phenyl]-8-cyano-3-phenylimidazo[1,2-a]pyridin-7-yl] methanimidate.
| Compound Name | [2-[4-(1-aminocyclobutyl)phenyl]-8-cyano-3-phenylimidazo[1,2-a]pyridin-7-yl] methanimidate |
|---|---|
| PubChem CID | 163636759 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [2-[4-(1-aminocyclobutyl)phenyl]-8-cyano-3-phenylimidazo[1,2-a]pyridin-7-yl] methanimidate |
| SMILES | [H]/N=C/Oc1ccn2c(-c3ccccc3)c(-c3ccc(C4(N)CCC4)cc3)nc2c1C#N |
| InChI | InChI=1S/C25H21N5O/c26-15-20-21(31-16-27)11-14-30-23(18-5-2-1-3-6-18)22(29-24(20)30)17-7-9-19(10-8-17)25(28)12-4-13-25/h1-3,5-11,14,16,27H,4,12-13,28H2/b27-16+ |
| InChIKey | IAUFBRGYCQDVES-JVWAILMASA-N |
| XLogP | 4.86 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|