About [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite
[[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite (PubChem CID 163637076) has the molecular formula C8H5F3NO4S-
and a molecular weight of 268.19 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite.
Molecular Properties
| Compound Name | [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite |
| PubChem CID | 163637076 |
| Molecular Formula | C8H5F3NO4S- |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite |
| SMILES | O=S([O-])ON=C(c1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H6F3NO4S/c9-8(10,11)7(12-16-17(14)15)5-1-3-6(13)4-2-5/h1-4,13H,(H,14,15)/p-1 |
| InChIKey | OUXGEKUJDPQJSP-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite?
The IUPAC name of [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite (CID 163637076) is [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite.
What is the SMILES notation for [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite?
The canonical SMILES for [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite is O=S([O-])ON=C(c1ccc(O)cc1)C(F)(F)F.
What is the InChIKey of [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite?
The InChIKey is OUXGEKUJDPQJSP-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6F3NO4S/c9-8(10,11)7(12-16-17(14)15)5-1-3-6(13)4-2-5/h1-4,13H,(H,14,15)/p-1.
What are the key properties of [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite?
[[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite has a molecular weight of 268.19 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,2,2-trifluoro-1-(4-hydroxyphenyl)ethylidene]amino] sulfite is sourced from PubChem (CID 163637076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).