C35H44BN5O4 — CID 163637538
tert-butyl (3S)-3-[[5-methyl-4-[1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 163637538) has the molecular formula C35H44BN5O4 and a molecular weight of 609.58 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[5-methyl-4-[1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[5-methyl-4-[1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163637538 |
| Molecular Formula | C35H44BN5O4 |
| Molecular Weight | 609.58 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | tert-butyl (3S)-3-[[5-methyl-4-[1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | Cc1cnc(N[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1-c1cn(-c2ccccc2)c2cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C35H44BN5O4/c1-23-20-37-31(38-25-13-12-18-40(21-25)32(42)43-33(2,3)4)39-30(23)28-22-41(26-14-10-9-11-15-26)29-19-24(16-17-27(28)29)36-44-34(5,6)35(7,8)45-36/h9-11,14-17,19-20,22,25H,12-13,18,21H2,1-8H3,(H,37,38,39)/t25-/m0/s1 |
| InChIKey | AOVPXNLGYQBNFG-VWLOTQADSA-N |
| XLogP | 6.51 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|