About N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine
N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine (PubChem CID 163638318) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine.
Molecular Properties
| Compound Name | N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine |
| PubChem CID | 163638318 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine |
| SMILES | C=NN1C(C)CC[C@H]1C |
| InChI | InChI=1S/C7H14N2/c1-6-4-5-7(2)9(6)8-3/h6-7H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | ICCCMWMRQQSFGW-ULUSZKPHSA-N |
| XLogP | 1.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine?
The IUPAC name of N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine (CID 163638318) is N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine.
What is the SMILES notation for N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine?
The canonical SMILES for N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine is C=NN1C(C)CC[C@H]1C.
What is the InChIKey of N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine?
The InChIKey is ICCCMWMRQQSFGW-ULUSZKPHSA-N. The full InChI is InChI=1S/C7H14N2/c1-6-4-5-7(2)9(6)8-3/h6-7H,3-5H2,1-2H3/t6-,7?/m1/s1.
What are the key properties of N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine?
N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine has a molecular weight of 126.20 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2,5-dimethylpyrrolidin-1-yl]methanimine is sourced from PubChem (CID 163638318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).