C12H24N2O5 — CID 163638463
tert-butyl N-[(3R)-4-hydroxy-3-(methoxycarbonylamino)-2-methylbutyl]carbamate (PubChem CID 163638463) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is tert-butyl N-[(3R)-4-hydroxy-3-(methoxycarbonylamino)-2-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-4-hydroxy-3-(methoxycarbonylamino)-2-methylbutyl]carbamate |
|---|---|
| PubChem CID | 163638463 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | tert-butyl N-[(3R)-4-hydroxy-3-(methoxycarbonylamino)-2-methylbutyl]carbamate |
| SMILES | COC(=O)N[C@@H](CO)C(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O5/c1-8(9(7-15)14-11(17)18-5)6-13-10(16)19-12(2,3)4/h8-9,15H,6-7H2,1-5H3,(H,13,16)(H,14,17)/t8?,9-/m0/s1 |
| InChIKey | ICFDORXACCYWOY-GKAPJAKFSA-N |
| XLogP | 0.86 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |