C25H38N2O — CID 163638608
1-[4-(4-methylphenyl)piperidin-1-yl]-2-[(1R)-2-piperidin-1-ylcyclohexyl]ethanone (PubChem CID 163638608) has the molecular formula C25H38N2O and a molecular weight of 382.59 g/mol. Its IUPAC name is 1-[4-(4-methylphenyl)piperidin-1-yl]-2-[(1R)-2-piperidin-1-ylcyclohexyl]ethanone.
| Compound Name | 1-[4-(4-methylphenyl)piperidin-1-yl]-2-[(1R)-2-piperidin-1-ylcyclohexyl]ethanone |
|---|---|
| PubChem CID | 163638608 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | 1-[4-(4-methylphenyl)piperidin-1-yl]-2-[(1R)-2-piperidin-1-ylcyclohexyl]ethanone |
| SMILES | Cc1ccc(C2CCN(C(=O)C[C@H]3CCCCC3N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H38N2O/c1-20-9-11-21(12-10-20)22-13-17-27(18-14-22)25(28)19-23-7-3-4-8-24(23)26-15-5-2-6-16-26/h9-12,22-24H,2-8,13-19H2,1H3/t23-,24?/m1/s1 |
| InChIKey | QKUOYWLOEZWRFS-MIHMCVIASA-N |
| XLogP | 5.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |