C11H18IN — CID 163639865
(4S)-3-iodo-2,4-dimethyl-1,2,3,4,6,7,8,8a-octahydroquinoline (PubChem CID 163639865) has the molecular formula C11H18IN and a molecular weight of 291.18 g/mol. Its IUPAC name is (4S)-3-iodo-2,4-dimethyl-1,2,3,4,6,7,8,8a-octahydroquinoline.
| Compound Name | (4S)-3-iodo-2,4-dimethyl-1,2,3,4,6,7,8,8a-octahydroquinoline |
|---|---|
| PubChem CID | 163639865 |
| Molecular Formula | C11H18IN |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | (4S)-3-iodo-2,4-dimethyl-1,2,3,4,6,7,8,8a-octahydroquinoline |
| SMILES | CC1NC2CCCC=C2[C@H](C)C1I |
| InChI | InChI=1S/C11H18IN/c1-7-9-5-3-4-6-10(9)13-8(2)11(7)12/h5,7-8,10-11,13H,3-4,6H2,1-2H3/t7-,8?,10?,11?/m0/s1 |
| InChIKey | IDHXXTVGSFJUPL-NQWXUOBUSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|