About 4-fluoro-N,N-dimethylbutanamide
4-fluoro-N,N-dimethylbutanamide (PubChem CID 163639971) has the molecular formula C6H12FNO
and a molecular weight of 133.17 g/mol. Its IUPAC name is 4-fluoro-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-fluoro-N,N-dimethylbutanamide |
| PubChem CID | 163639971 |
| Molecular Formula | C6H12FNO |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4-fluoro-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCF |
| InChI | InChI=1S/C6H12FNO/c1-8(2)6(9)4-3-5-7/h3-5H2,1-2H3 |
| InChIKey | IDKFIYARQSBVSM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,N-dimethylbutanamide?
The IUPAC name of 4-fluoro-N,N-dimethylbutanamide (CID 163639971) is 4-fluoro-N,N-dimethylbutanamide.
What is the SMILES notation for 4-fluoro-N,N-dimethylbutanamide?
The canonical SMILES for 4-fluoro-N,N-dimethylbutanamide is CN(C)C(=O)CCCF.
What is the InChIKey of 4-fluoro-N,N-dimethylbutanamide?
The InChIKey is IDKFIYARQSBVSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FNO/c1-8(2)6(9)4-3-5-7/h3-5H2,1-2H3.
What are the key properties of 4-fluoro-N,N-dimethylbutanamide?
4-fluoro-N,N-dimethylbutanamide has a molecular weight of 133.17 g/mol, XLogP of 0.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,N-dimethylbutanamide is sourced from PubChem (CID 163639971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).