C19H29BF3NO2 — CID 163640334
1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-dien-1-yl]methyl]-4-(trifluoromethyl)piperidine (PubChem CID 163640334) has the molecular formula C19H29BF3NO2 and a molecular weight of 371.25 g/mol. Its IUPAC name is 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-dien-1-yl]methyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-dien-1-yl]methyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 163640334 |
| Molecular Formula | C19H29BF3NO2 |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-dien-1-yl]methyl]-4-(trifluoromethyl)piperidine |
| SMILES | CC1(C)OB(C2C=CC(CN3CCC(C(F)(F)F)CC3)=CC2)OC1(C)C |
| InChI | InChI=1S/C19H29BF3NO2/c1-17(2)18(3,4)26-20(25-17)16-7-5-14(6-8-16)13-24-11-9-15(10-12-24)19(21,22)23/h5-7,15-16H,8-13H2,1-4H3 |
| InChIKey | IDRTVRCNLLYGIW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|