About 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one
5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one (PubChem CID 163640637) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one |
| PubChem CID | 163640637 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one |
| SMILES | C=C/C=C\c1cc(C)c(=O)[nH]c1NC |
| InChI | InChI=1S/C11H14N2O/c1-4-5-6-9-7-8(2)11(14)13-10(9)12-3/h4-7H,1H2,2-3H3,(H2,12,13,14)/b6-5- |
| InChIKey | IDYQEFHKFUJHBG-WAYWQWQTSA-N |
| XLogP | 1.92 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one (CID 163640637) is 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one is C=C/C=C\c1cc(C)c(=O)[nH]c1NC.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one?
The InChIKey is IDYQEFHKFUJHBG-WAYWQWQTSA-N. The full InChI is InChI=1S/C11H14N2O/c1-4-5-6-9-7-8(2)11(14)13-10(9)12-3/h4-7H,1H2,2-3H3,(H2,12,13,14)/b6-5-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one?
5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one has a molecular weight of 190.25 g/mol, XLogP of 1.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(methylamino)-1H-pyridin-2-one is sourced from PubChem (CID 163640637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).