About (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine
(1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine (PubChem CID 163641149) has the molecular formula C6H14ClN3
and a molecular weight of 163.65 g/mol. Its IUPAC name is (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine.
Molecular Properties
| Compound Name | (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine |
| PubChem CID | 163641149 |
| Molecular Formula | C6H14ClN3 |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine |
| SMILES | C=C(Cl)N[C@@H](C)N[C@@H](C)N |
| InChI | InChI=1S/C6H14ClN3/c1-4(7)9-6(3)10-5(2)8/h5-6,9-10H,1,8H2,2-3H3/t5-,6+/m0/s1 |
| InChIKey | IEIUDJRHXSWIMC-NTSWFWBYSA-N |
| XLogP | 0.53 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine?
The IUPAC name of (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine (CID 163641149) is (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine.
What is the SMILES notation for (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine?
The canonical SMILES for (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine is C=C(Cl)N[C@@H](C)N[C@@H](C)N.
What is the InChIKey of (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine?
The InChIKey is IEIUDJRHXSWIMC-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H14ClN3/c1-4(7)9-6(3)10-5(2)8/h5-6,9-10H,1,8H2,2-3H3/t5-,6+/m0/s1.
What are the key properties of (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine?
(1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine has a molecular weight of 163.65 g/mol, XLogP of 0.53, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-N'-[(1S)-1-(1-chloroethenylamino)ethyl]ethane-1,1-diamine is sourced from PubChem (CID 163641149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).