About di(cyclohexa-2,4-dien-1-yloxy)methanimine
di(cyclohexa-2,4-dien-1-yloxy)methanimine (PubChem CID 163641188) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is di(cyclohexa-2,4-dien-1-yloxy)methanimine.
Molecular Properties
| Compound Name | di(cyclohexa-2,4-dien-1-yloxy)methanimine |
| PubChem CID | 163641188 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | di(cyclohexa-2,4-dien-1-yloxy)methanimine |
| SMILES | [H]N=C(OC1C=CC=CC1)OC1C=CC=CC1 |
| InChI | InChI=1S/C13H15NO2/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-7,9,11-12,14H,8,10H2 |
| InChIKey | IEJPFMQEAXSIAD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze di(cyclohexa-2,4-dien-1-yloxy)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclohexa-2,4-dien-1-yloxy)methanimine?
The IUPAC name of di(cyclohexa-2,4-dien-1-yloxy)methanimine (CID 163641188) is di(cyclohexa-2,4-dien-1-yloxy)methanimine.
What is the SMILES notation for di(cyclohexa-2,4-dien-1-yloxy)methanimine?
The canonical SMILES for di(cyclohexa-2,4-dien-1-yloxy)methanimine is [H]N=C(OC1C=CC=CC1)OC1C=CC=CC1.
What is the InChIKey of di(cyclohexa-2,4-dien-1-yloxy)methanimine?
The InChIKey is IEJPFMQEAXSIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-7,9,11-12,14H,8,10H2.
What are the key properties of di(cyclohexa-2,4-dien-1-yloxy)methanimine?
di(cyclohexa-2,4-dien-1-yloxy)methanimine has a molecular weight of 217.27 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclohexa-2,4-dien-1-yloxy)methanimine is sourced from PubChem (CID 163641188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).