C30H38F3N3O — CID 163641515
2-[2-[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]hydrazinyl]-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 163641515) has the molecular formula C30H38F3N3O and a molecular weight of 513.65 g/mol. Its IUPAC name is 2-[2-[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]hydrazinyl]-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-[2-[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]hydrazinyl]-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 163641515 |
| Molecular Formula | C30H38F3N3O |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 2-[2-[6-amino-3-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]hydrazinyl]-6-(2-phenylpropan-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(NN=C2C=C(C(F)(F)F)C=CC2N)c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C30H38F3N3O/c1-27(2,3)18-28(4,5)21-15-22(29(6,7)19-11-9-8-10-12-19)26(37)25(17-21)36-35-24-16-20(30(31,32)33)13-14-23(24)34/h8-17,23,36-37H,18,34H2,1-7H3 |
| InChIKey | IEQWOZZUDWLTDE-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|