C26H32O5 — CID 163641691
[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] (E)-3-(3-methylphenyl)prop-2-enoate (PubChem CID 163641691) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is [(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] (E)-3-(3-methylphenyl)prop-2-enoate.
| Compound Name | [(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] (E)-3-(3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163641691 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] (E)-3-(3-methylphenyl)prop-2-enoate |
| SMILES | Cc1cccc(/C=C/C(=O)O[C@@H]2C[C@H]3[C@H](O)/C=C/C(=O)O[C@@H](C)CCC/C=C/[C@@H]3C2)c1 |
| InChI | InChI=1S/C26H32O5/c1-18-7-6-9-20(15-18)11-13-26(29)31-22-16-21-10-5-3-4-8-19(2)30-25(28)14-12-24(27)23(21)17-22/h5-7,9-15,19,21-24,27H,3-4,8,16-17H2,1-2H3/b10-5+,13-11+,14-12+/t19-,21+,22-,23+,24+/m0/s1 |
| InChIKey | SCWYIZCHVFVJOH-DXJXPIQXSA-N |
| XLogP | 4.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|