C11H17BrOS — CID 163642001
1-[(3E,5E)-6-bromohepta-1,3,5-trien-3-yl]sulfanyl-2-methylpropan-2-ol (PubChem CID 163642001) has the molecular formula C11H17BrOS and a molecular weight of 277.23 g/mol. Its IUPAC name is 1-[(3E,5E)-6-bromohepta-1,3,5-trien-3-yl]sulfanyl-2-methylpropan-2-ol.
| Compound Name | 1-[(3E,5E)-6-bromohepta-1,3,5-trien-3-yl]sulfanyl-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 163642001 |
| Molecular Formula | C11H17BrOS |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 1-[(3E,5E)-6-bromohepta-1,3,5-trien-3-yl]sulfanyl-2-methylpropan-2-ol |
| SMILES | C=C/C(=C\C=C(/C)Br)SCC(C)(C)O |
| InChI | InChI=1S/C11H17BrOS/c1-5-10(7-6-9(2)12)14-8-11(3,4)13/h5-7,13H,1,8H2,2-4H3/b9-6+,10-7+ |
| InChIKey | IFANTVOBYQMKIF-KZZDLZNXSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|