C22H24N4O2S — CID 163642169
N-[2-(3,4-dimethoxyphenyl)ethyl]-11-propyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 163642169) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-11-propyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-11-propyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 163642169 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-11-propyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | CCCc1ccc2c(n1)sc1c(NCCc3ccc(OC)c(OC)c3)ncnc12 |
| InChI | InChI=1S/C22H24N4O2S/c1-4-5-15-7-8-16-19-20(29-22(16)26-15)21(25-13-24-19)23-11-10-14-6-9-17(27-2)18(12-14)28-3/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,23,24,25) |
| InChIKey | IFEMHCNYOQWORI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |