C23H33NO8 — CID 163642476
(4S,5S)-5-[[(2R)-8-butoxy-5-hydroxy-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]-4,7-dihydroxy-4-(hydroxymethyl)-3-oxoheptanamide (PubChem CID 163642476) has the molecular formula C23H33NO8 and a molecular weight of 451.52 g/mol. Its IUPAC name is (4S,5S)-5-[[(2R)-8-butoxy-5-hydroxy-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]-4,7-dihydroxy-4-(hydroxymethyl)-3-oxoheptanamide.
| Compound Name | (4S,5S)-5-[[(2R)-8-butoxy-5-hydroxy-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]-4,7-dihydroxy-4-(hydroxymethyl)-3-oxoheptanamide |
|---|---|
| PubChem CID | 163642476 |
| Molecular Formula | C23H33NO8 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (4S,5S)-5-[[(2R)-8-butoxy-5-hydroxy-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]-4,7-dihydroxy-4-(hydroxymethyl)-3-oxoheptanamide |
| SMILES | CCCCOc1ccc(O)c2c1C[C@@H](C[C@@H](CCO)[C@](O)(CO)C(=O)CC(N)=O)CC2=O |
| InChI | InChI=1S/C23H33NO8/c1-2-3-8-32-19-5-4-17(27)22-16(19)10-14(11-18(22)28)9-15(6-7-25)23(31,13-26)20(29)12-21(24)30/h4-5,14-15,25-27,31H,2-3,6-13H2,1H3,(H2,24,30)/t14-,15-,23-/m1/s1 |
| InChIKey | IFLMZUCCBICRSE-GGOJBBCOSA-N |
| XLogP | 0.87 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|