About N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide
N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide (PubChem CID 163644583) has the molecular formula C5H9N3S
and a molecular weight of 143.21 g/mol. Its IUPAC name is N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide.
Molecular Properties
| Compound Name | N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide |
| PubChem CID | 163644583 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide |
| SMILES | CC(=S)/N=C(N)/C=C\N |
| InChI | InChI=1S/C5H9N3S/c1-4(9)8-5(7)2-3-6/h2-3H,6H2,1H3,(H2,7,8,9)/b3-2- |
| InChIKey | IHEASAWEORLUHX-IHWYPQMZSA-N |
| XLogP | 0.16 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide?
The IUPAC name of N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide (CID 163644583) is N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide.
What is the SMILES notation for N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide?
The canonical SMILES for N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide is CC(=S)/N=C(N)/C=C\N.
What is the InChIKey of N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide?
The InChIKey is IHEASAWEORLUHX-IHWYPQMZSA-N. The full InChI is InChI=1S/C5H9N3S/c1-4(9)8-5(7)2-3-6/h2-3H,6H2,1H3,(H2,7,8,9)/b3-2-.
What are the key properties of N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide?
N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide has a molecular weight of 143.21 g/mol, XLogP of 0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1,3-diaminoprop-2-enylidene]ethanethioamide is sourced from PubChem (CID 163644583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).