About 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate
2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate (PubChem CID 163644792) has the molecular formula C29H26F3NO3
and a molecular weight of 493.53 g/mol. Its IUPAC name is 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate.
Molecular Properties
| Compound Name | 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate |
| PubChem CID | 163644792 |
| Molecular Formula | C29H26F3NO3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate |
| SMILES | CC(C)(C)c1ccc(C(C#N)(C(=O)OCCc2ccccc2)C(=O)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H26F3NO3/c1-27(2,3)21-13-15-22(16-14-21)28(19-33,26(35)36-18-17-20-9-5-4-6-10-20)25(34)23-11-7-8-12-24(23)29(30,31)32/h4-16H,17-18H2,1-3H3 |
| InChIKey | IHIHJLMSUQTFMY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate?
The IUPAC name of 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate (CID 163644792) is 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate.
What is the SMILES notation for 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate?
The canonical SMILES for 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate is CC(C)(C)c1ccc(C(C#N)(C(=O)OCCc2ccccc2)C(=O)c2ccccc2C(F)(F)F)cc1.
What is the InChIKey of 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate?
The InChIKey is IHIHJLMSUQTFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26F3NO3/c1-27(2,3)21-13-15-22(16-14-21)28(19-33,26(35)36-18-17-20-9-5-4-6-10-20)25(34)23-11-7-8-12-24(23)29(30,31)32/h4-16H,17-18H2,1-3H3.
What are the key properties of 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate?
2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate has a molecular weight of 493.53 g/mol, XLogP of 6.43, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate is sourced from PubChem (CID 163644792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).