C26H25F4N8O+ — CID 163644846
N-[2-[6-amino-3-(3,5-difluorophenyl)pyridazin-1-ium-1-yl]-2-iminoethyl]-7-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]-1,5-naphthyridin-4-amine (PubChem CID 163644846) has the molecular formula C26H25F4N8O+ and a molecular weight of 541.53 g/mol. Its IUPAC name is N-[2-[6-amino-3-(3,5-difluorophenyl)pyridazin-1-ium-1-yl]-2-iminoethyl]-7-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]-1,5-naphthyridin-4-amine.
| Compound Name | N-[2-[6-amino-3-(3,5-difluorophenyl)pyridazin-1-ium-1-yl]-2-iminoethyl]-7-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 163644846 |
| Molecular Formula | C26H25F4N8O+ |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | N-[2-[6-amino-3-(3,5-difluorophenyl)pyridazin-1-ium-1-yl]-2-iminoethyl]-7-[2-(3,3-difluoropyrrolidin-1-yl)ethoxy]-1,5-naphthyridin-4-amine |
| SMILES | [H]/N=C(/CNc1ccnc2cc(OCCN3CCC(F)(F)C3)cnc12)[n+]1nc(-c2cc(F)cc(F)c2)ccc1N |
| InChI | InChI=1S/C26H24F4N8O/c27-17-9-16(10-18(28)11-17)20-1-2-23(31)38(36-20)24(32)14-34-21-3-5-33-22-12-19(13-35-25(21)22)39-8-7-37-6-4-26(29,30)15-37/h1-3,5,9-13,31-32H,4,6-8,14-15H2,(H,33,34)/p+1/b32-24- |
| InChIKey | IHJGKAHTQVMJMM-TZHWMEPESA-O |
| XLogP | 3.50 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|