C21H23ClFIN5O2- — CID 163644917
CID 163644917 (PubChem CID 163644917) has the molecular formula C21H23ClFIN5O2- and a molecular weight of 558.80 g/mol.
| Compound Name | CID 163644917 |
|---|---|
| PubChem CID | 163644917 |
| Molecular Formula | C21H23ClFIN5O2- |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | — |
| SMILES | O=c1n(CCCN2C3C[I-]C2CC(OCc2ccccc2F)C3)nc2ccc(Cl)nn12 |
| InChI | InChI=1S/C21H23ClFIN5O2/c22-18-6-7-20-26-28(21(30)29(20)25-18)9-3-8-27-15-10-16(11-19(27)24-12-15)31-13-14-4-1-2-5-17(14)23/h1-2,4-7,15-16,19H,3,8-13H2/q-1 |
| InChIKey | YIBGMZUHEBPWGJ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|