C28H40N2O2 — CID 163646049
5-[2-[(3aS,4R,5S,7aS)-5-ethyl-7a-methyl-1-(5-propoxy-3-pyridinyl)-3,3a,4,5,6,7-hexahydroinden-4-yl]ethyl]-1,2,3,4-tetrahydroazepin-7-one (PubChem CID 163646049) has the molecular formula C28H40N2O2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 5-[2-[(3aS,4R,5S,7aS)-5-ethyl-7a-methyl-1-(5-propoxy-3-pyridinyl)-3,3a,4,5,6,7-hexahydroinden-4-yl]ethyl]-1,2,3,4-tetrahydroazepin-7-one.
| Compound Name | 5-[2-[(3aS,4R,5S,7aS)-5-ethyl-7a-methyl-1-(5-propoxy-3-pyridinyl)-3,3a,4,5,6,7-hexahydroinden-4-yl]ethyl]-1,2,3,4-tetrahydroazepin-7-one |
|---|---|
| PubChem CID | 163646049 |
| Molecular Formula | C28H40N2O2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 5-[2-[(3aS,4R,5S,7aS)-5-ethyl-7a-methyl-1-(5-propoxy-3-pyridinyl)-3,3a,4,5,6,7-hexahydroinden-4-yl]ethyl]-1,2,3,4-tetrahydroazepin-7-one |
| SMILES | CCCOc1cncc(C2=CC[C@H]3[C@H](CCC4=CC(=O)NCCC4)[C@@H](CC)CC[C@]23C)c1 |
| InChI | InChI=1S/C28H40N2O2/c1-4-15-32-23-17-22(18-29-19-23)25-10-11-26-24(21(5-2)12-13-28(25,26)3)9-8-20-7-6-14-30-27(31)16-20/h10,16-19,21,24,26H,4-9,11-15H2,1-3H3,(H,30,31)/t21-,24+,26-,28+/m0/s1 |
| InChIKey | IIHNITSFRDXHME-MFGMTNNKSA-N |
| XLogP | 6.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |