About 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione
6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione (PubChem CID 163646056) has the molecular formula C15H18O4
and a molecular weight of 262.30 g/mol. Its IUPAC name is 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione.
Molecular Properties
| Compound Name | 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione |
| PubChem CID | 163646056 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione |
| SMILES | CCCC(=O)C1=CC2=C(COC(=O)C2CC)C(=O)C1 |
| InChI | InChI=1S/C15H18O4/c1-3-5-13(16)9-6-11-10(4-2)15(18)19-8-12(11)14(17)7-9/h6,10H,3-5,7-8H2,1-2H3 |
| InChIKey | IIHQRGBGKYTSEN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione?
The IUPAC name of 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione (CID 163646056) is 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione.
What is the SMILES notation for 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione?
The canonical SMILES for 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione is CCCC(=O)C1=CC2=C(COC(=O)C2CC)C(=O)C1.
What is the InChIKey of 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione?
The InChIKey is IIHQRGBGKYTSEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O4/c1-3-5-13(16)9-6-11-10(4-2)15(18)19-8-12(11)14(17)7-9/h6,10H,3-5,7-8H2,1-2H3.
What are the key properties of 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione?
6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione has a molecular weight of 262.30 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butanoyl-4-ethyl-4,7-dihydro-1H-isochromene-3,8-dione is sourced from PubChem (CID 163646056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).