C21H22F3N3O3 — CID 163646174
(1R,2R,4S,5R,6S)-4-(1,3-dimethylpyrazol-4-yl)-6-hydroxy-N-[3-methyl-5-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide (PubChem CID 163646174) has the molecular formula C21H22F3N3O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is (1R,2R,4S,5R,6S)-4-(1,3-dimethylpyrazol-4-yl)-6-hydroxy-N-[3-methyl-5-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide.
| Compound Name | (1R,2R,4S,5R,6S)-4-(1,3-dimethylpyrazol-4-yl)-6-hydroxy-N-[3-methyl-5-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide |
|---|---|
| PubChem CID | 163646174 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (1R,2R,4S,5R,6S)-4-(1,3-dimethylpyrazol-4-yl)-6-hydroxy-N-[3-methyl-5-(trifluoromethyl)phenyl]-8-oxatricyclo[3.2.1.02,4]octane-2-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@]23C[C@@]2(c2cn(C)nc2C)[C@H]2O[C@@H]3C[C@@H]2O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N3O3/c1-10-4-12(21(22,23)24)6-13(5-10)25-18(29)20-9-19(20,14-8-27(3)26-11(14)2)17-15(28)7-16(20)30-17/h4-6,8,15-17,28H,7,9H2,1-3H3,(H,25,29)/t15-,16+,17-,19+,20+/m0/s1 |
| InChIKey | IIKAPDLVSHAICY-YQXATGRUSA-N |
| XLogP | 2.85 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |