About trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid
trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid (PubChem CID 163646178) has the molecular formula C11H14N2O4
and a molecular weight of 238.24 g/mol. Its IUPAC name is trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid |
| PubChem CID | 163646178 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1C(=O)O)c1ccno1 |
| InChI | InChI=1S/C11H14N2O4/c14-10(9-5-6-12-17-9)13-8-4-2-1-3-7(8)11(15)16/h5-8H,1-4H2,(H,13,14)(H,15,16)/t7-,8-/m1/s1 |
| InChIKey | IIKCOPOYTULFLM-HTQZYQBOSA-N |
| XLogP | 1.05 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid?
The IUPAC name of trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid (CID 163646178) is trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid is O=C(N[C@@H]1CCCC[C@H]1C(=O)O)c1ccno1.
What is the InChIKey of trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid?
The InChIKey is IIKCOPOYTULFLM-HTQZYQBOSA-N. The full InChI is InChI=1S/C11H14N2O4/c14-10(9-5-6-12-17-9)13-8-4-2-1-3-7(8)11(15)16/h5-8H,1-4H2,(H,13,14)(H,15,16)/t7-,8-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid?
trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid has a molecular weight of 238.24 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(1,2-oxazole-5-carbonylamino)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 163646178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).