C19H34O — CID 163646256
(6R)-6-[(1R,3aS,7aR)-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol (PubChem CID 163646256) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,7aR)-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aS,7aR)-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 163646256 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (6R)-6-[(1R,3aS,7aR)-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
| SMILES | C=C1CCC[C@]2(C)[C@@H]([C@H](C)CCCC(C)(C)O)CC[C@@H]12 |
| InChI | InChI=1S/C19H34O/c1-14(8-6-12-18(3,4)20)16-10-11-17-15(2)9-7-13-19(16,17)5/h14,16-17,20H,2,6-13H2,1,3-5H3/t14-,16-,17+,19-/m1/s1 |
| InChIKey | IILRGJRSGXKUQA-VYCZESIESA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|