C29H40N2O7 — CID 163646659
3,10-dihydroxy-1-methyl-5-[(E)-2,3,10,11-tetrahydroxy-3,7,11-trimethyldodec-6-enyl]-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 163646659) has the molecular formula C29H40N2O7 and a molecular weight of 528.65 g/mol. Its IUPAC name is 3,10-dihydroxy-1-methyl-5-[(E)-2,3,10,11-tetrahydroxy-3,7,11-trimethyldodec-6-enyl]-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 3,10-dihydroxy-1-methyl-5-[(E)-2,3,10,11-tetrahydroxy-3,7,11-trimethyldodec-6-enyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 163646659 |
| Molecular Formula | C29H40N2O7 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 3,10-dihydroxy-1-methyl-5-[(E)-2,3,10,11-tetrahydroxy-3,7,11-trimethyldodec-6-enyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | C/C(=C\CCC(C)(O)C(O)CN1C(=O)c2cccc(O)c2Nc2c(C)cc(O)cc21)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C29H40N2O7/c1-17(11-12-23(34)28(3,4)37)8-7-13-29(5,38)24(35)16-31-21-15-19(32)14-18(2)25(21)30-26-20(27(31)36)9-6-10-22(26)33/h6,8-10,14-15,23-24,30,32-35,37-38H,7,11-13,16H2,1-5H3/b17-8+ |
| InChIKey | IIUGBWXLVGVORV-CAOOACKPSA-N |
| XLogP | 3.86 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|