About 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol
1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol (PubChem CID 163646818) has the molecular formula C10H12F3NS
and a molecular weight of 235.27 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol.
Molecular Properties
| Compound Name | 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol |
| PubChem CID | 163646818 |
| Molecular Formula | C10H12F3NS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol |
| SMILES | CC(S)C1=C/N=C(/C(F)(F)F)CCC=C1 |
| InChI | InChI=1S/C10H12F3NS/c1-7(15)8-4-2-3-5-9(14-6-8)10(11,12)13/h2,4,6-7,15H,3,5H2,1H3/b4-2?,8-6?,14-9+ |
| InChIKey | IIXVAPQLJRLKMD-OWYARZQNSA-N |
| XLogP | 3.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol?
The IUPAC name of 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol (CID 163646818) is 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol.
What is the SMILES notation for 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol?
The canonical SMILES for 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol is CC(S)C1=C/N=C(/C(F)(F)F)CCC=C1.
What is the InChIKey of 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol?
The InChIKey is IIXVAPQLJRLKMD-OWYARZQNSA-N. The full InChI is InChI=1S/C10H12F3NS/c1-7(15)8-4-2-3-5-9(14-6-8)10(11,12)13/h2,4,6-7,15H,3,5H2,1H3/b4-2?,8-6?,14-9+.
What are the key properties of 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol?
1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol has a molecular weight of 235.27 g/mol, XLogP of 3.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(trifluoromethyl)-3,4-dihydroazocin-7-yl]ethanethiol is sourced from PubChem (CID 163646818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).