About tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate
tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate (PubChem CID 163647405) has the molecular formula C17H23F2N3O2
and a molecular weight of 339.39 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate |
| PubChem CID | 163647405 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate |
| SMILES | C[C@@H](C/N=C/C=C(N)c1ccc(F)c(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23F2N3O2/c1-11(22-16(23)24-17(2,3)4)10-21-8-7-15(20)12-5-6-13(18)14(19)9-12/h5-9,11H,10,20H2,1-4H3,(H,22,23)/b15-7?,21-8+/t11-/m0/s1 |
| InChIKey | KBJOPFJWBPFMDB-GBALWQBQSA-N |
| XLogP | 3.25 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate (CID 163647405) is tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate is C[C@@H](C/N=C/C=C(N)c1ccc(F)c(F)c1)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate?
The InChIKey is KBJOPFJWBPFMDB-GBALWQBQSA-N. The full InChI is InChI=1S/C17H23F2N3O2/c1-11(22-16(23)24-17(2,3)4)10-21-8-7-15(20)12-5-6-13(18)14(19)9-12/h5-9,11H,10,20H2,1-4H3,(H,22,23)/b15-7?,21-8+/t11-/m0/s1.
What are the key properties of tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate?
tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate has a molecular weight of 339.39 g/mol, XLogP of 3.25, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-1-[[3-amino-3-(3,4-difluorophenyl)prop-2-enylidene]amino]propan-2-yl]carbamate is sourced from PubChem (CID 163647405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).