About [methylperoxy(oxido)azaniumyl]oxymethane;uranium
[methylperoxy(oxido)azaniumyl]oxymethane;uranium (PubChem CID 163648734) has the molecular formula C2H7NO4U
and a molecular weight of 347.11 g/mol. Its IUPAC name is [methylperoxy(oxido)azaniumyl]oxymethane;uranium.
Molecular Properties
| Compound Name | [methylperoxy(oxido)azaniumyl]oxymethane;uranium |
| PubChem CID | 163648734 |
| Molecular Formula | C2H7NO4U |
| Molecular Weight | 347.11 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | [methylperoxy(oxido)azaniumyl]oxymethane;uranium |
| SMILES | COO[NH+]([O-])OC.[U] |
| InChI | InChI=1S/C2H7NO4.U/c1-5-3(4)7-6-2;/h3H,1-2H3; |
| InChIKey | IKKHGPCUGDKZJA-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.11 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [methylperoxy(oxido)azaniumyl]oxymethane;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methylperoxy(oxido)azaniumyl]oxymethane;uranium?
The IUPAC name of [methylperoxy(oxido)azaniumyl]oxymethane;uranium (CID 163648734) is [methylperoxy(oxido)azaniumyl]oxymethane;uranium.
What is the SMILES notation for [methylperoxy(oxido)azaniumyl]oxymethane;uranium?
The canonical SMILES for [methylperoxy(oxido)azaniumyl]oxymethane;uranium is COO[NH+]([O-])OC.[U].
What is the InChIKey of [methylperoxy(oxido)azaniumyl]oxymethane;uranium?
The InChIKey is IKKHGPCUGDKZJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO4.U/c1-5-3(4)7-6-2;/h3H,1-2H3;.
What are the key properties of [methylperoxy(oxido)azaniumyl]oxymethane;uranium?
[methylperoxy(oxido)azaniumyl]oxymethane;uranium has a molecular weight of 347.11 g/mol, XLogP of -1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [methylperoxy(oxido)azaniumyl]oxymethane;uranium is sourced from PubChem (CID 163648734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).