C10H10O3 — CID 163649355
(6S)-4-oxatetracyclo[5.2.1.11,7.02,6]undecane-3,5-dione (PubChem CID 163649355) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (6S)-4-oxatetracyclo[5.2.1.11,7.02,6]undecane-3,5-dione.
| Compound Name | (6S)-4-oxatetracyclo[5.2.1.11,7.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 163649355 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (6S)-4-oxatetracyclo[5.2.1.11,7.02,6]undecane-3,5-dione |
| SMILES | O=C1OC(=O)[C@H]2C1C13CCC2(C1)C3 |
| InChI | InChI=1S/C10H10O3/c11-7-5-6(8(12)13-7)10-2-1-9(5,3-10)4-10/h5-6H,1-4H2/t5-,6?,9?,10?/m1/s1 |
| InChIKey | IKXQDWCZDVHXPE-DFPAFLFDSA-N |
| XLogP | 0.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|