C18H14 — CID 163649392
4-phenyl-1,2-dihydrocyclobuta[a]naphthalene (PubChem CID 163649392) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-phenyl-1,2-dihydrocyclobuta[a]naphthalene.
| Compound Name | 4-phenyl-1,2-dihydrocyclobuta[a]naphthalene |
|---|---|
| PubChem CID | 163649392 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-phenyl-1,2-dihydrocyclobuta[a]naphthalene |
| SMILES | c1ccc(-c2cc3c(c4ccccc24)CC3)cc1 |
| InChI | InChI=1S/C18H14/c1-2-6-13(7-3-1)18-12-14-10-11-15(14)16-8-4-5-9-17(16)18/h1-9,12H,10-11H2 |
| InChIKey | IKYWSKMWLIZAER-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |