About 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one
3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one (PubChem CID 163651085) has the molecular formula C10H11N5O
and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one.
Molecular Properties
| Compound Name | 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one |
| PubChem CID | 163651085 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one |
| SMILES | C=C1Cn2c(nc3c(ncn3CC)c2=O)N1 |
| InChI | InChI=1S/C10H11N5O/c1-3-14-5-11-7-8(14)13-10-12-6(2)4-15(10)9(7)16/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | RFEWHJNMNQFPGL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one?
The IUPAC name of 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one (CID 163651085) is 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one.
What is the SMILES notation for 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one?
The canonical SMILES for 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one is C=C1Cn2c(nc3c(ncn3CC)c2=O)N1.
What is the InChIKey of 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one?
The InChIKey is RFEWHJNMNQFPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O/c1-3-14-5-11-7-8(14)13-10-12-6(2)4-15(10)9(7)16/h5H,2-4H2,1H3,(H,12,13).
What are the key properties of 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one?
3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one has a molecular weight of 217.23 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-methylidene-5,7-dihydroimidazo[1,2-a]purin-9-one is sourced from PubChem (CID 163651085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).