C15H25N3O3 — CID 163651262
N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-3-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 163651262) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-3-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-3-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163651262 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-3-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | CC(C)C1CCNC1C(=O)NC(CC1CC1)C(=O)C(N)=O |
| InChI | InChI=1S/C15H25N3O3/c1-8(2)10-5-6-17-12(10)15(21)18-11(7-9-3-4-9)13(19)14(16)20/h8-12,17H,3-7H2,1-2H3,(H2,16,20)(H,18,21) |
| InChIKey | IMLIPCRSIQHPCJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|