C10H20N2O2 — CID 163651386
3-acetamido-3-ethyl-4-methylpentanamide (PubChem CID 163651386) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-acetamido-3-ethyl-4-methylpentanamide.
| Compound Name | 3-acetamido-3-ethyl-4-methylpentanamide |
|---|---|
| PubChem CID | 163651386 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 3-acetamido-3-ethyl-4-methylpentanamide |
| SMILES | CCC(CC(N)=O)(NC(C)=O)C(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-5-10(7(2)3,6-9(11)14)12-8(4)13/h7H,5-6H2,1-4H3,(H2,11,14)(H,12,13) |
| InChIKey | IMOAGPDTYWSNGH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |