C14H22FNO4 — CID 163651503
3-[1-(1-fluoroethenyl)cyclobutyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 163651503) has the molecular formula C14H22FNO4 and a molecular weight of 287.33 g/mol. Its IUPAC name is 3-[1-(1-fluoroethenyl)cyclobutyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[1-(1-fluoroethenyl)cyclobutyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 163651503 |
| Molecular Formula | C14H22FNO4 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[1-(1-fluoroethenyl)cyclobutyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | C=C(F)C1(CC(NC(=O)OC(C)(C)C)C(=O)O)CCC1 |
| InChI | InChI=1S/C14H22FNO4/c1-9(15)14(6-5-7-14)8-10(11(17)18)16-12(19)20-13(2,3)4/h10H,1,5-8H2,2-4H3,(H,16,19)(H,17,18) |
| InChIKey | IMQHQMKMENWYOK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |