About (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane
(1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane (PubChem CID 163653038) has the molecular formula C16H20FNO
and a molecular weight of 261.34 g/mol. Its IUPAC name is (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane.
Molecular Properties
| Compound Name | (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane |
| PubChem CID | 163653038 |
| Molecular Formula | C16H20FNO |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane |
| SMILES | FCc1ccc(COC2CC3NC4CC[C@@]43C2)cc1 |
| InChI | InChI=1S/C16H20FNO/c17-9-11-1-3-12(4-2-11)10-19-13-7-15-16(8-13)6-5-14(16)18-15/h1-4,13-15,18H,5-10H2/t13?,14?,15?,16-/m1/s1 |
| InChIKey | INVRBQWJQSDNNN-LGGPCSOHSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane?
The IUPAC name of (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane (CID 163653038) is (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane.
What is the SMILES notation for (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane?
The canonical SMILES for (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane is FCc1ccc(COC2CC3NC4CC[C@@]43C2)cc1.
What is the InChIKey of (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane?
The InChIKey is INVRBQWJQSDNNN-LGGPCSOHSA-N. The full InChI is InChI=1S/C16H20FNO/c17-9-11-1-3-12(4-2-11)10-19-13-7-15-16(8-13)6-5-14(16)18-15/h1-4,13-15,18H,5-10H2/t13?,14?,15?,16-/m1/s1.
What are the key properties of (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane?
(1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane has a molecular weight of 261.34 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-8-[[4-(fluoromethyl)phenyl]methoxy]-5-azatricyclo[4.3.0.01,4]nonane is sourced from PubChem (CID 163653038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).