C22H18IN3O3S — CID 163653041
8-iodo-3-methyl-1-[4-[1-[methyl-oxo-(oxomethylidene)-λ6-sulfanyl]cyclopropyl]phenyl]imidazo[4,5-c]quinolin-2-one (PubChem CID 163653041) has the molecular formula C22H18IN3O3S and a molecular weight of 531.38 g/mol. Its IUPAC name is 8-iodo-3-methyl-1-[4-[1-[methyl-oxo-(oxomethylidene)-λ6-sulfanyl]cyclopropyl]phenyl]imidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-iodo-3-methyl-1-[4-[1-[methyl-oxo-(oxomethylidene)-λ6-sulfanyl]cyclopropyl]phenyl]imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 163653041 |
| Molecular Formula | C22H18IN3O3S |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | 8-iodo-3-methyl-1-[4-[1-[methyl-oxo-(oxomethylidene)-λ6-sulfanyl]cyclopropyl]phenyl]imidazo[4,5-c]quinolin-2-one |
| SMILES | Cn1c(=O)n(-c2ccc(C3(S(C)(=O)=C=O)CC3)cc2)c2c3cc(I)ccc3ncc21 |
| InChI | InChI=1S/C22H18IN3O3S/c1-25-19-12-24-18-8-5-15(23)11-17(18)20(19)26(21(25)28)16-6-3-14(4-7-16)22(9-10-22)30(2,29)13-27/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | INVSTLMDUVQWIX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|