C20H25NO3S — CID 163653216
(2S)-2-methyl-5-oxo-5-[3-[5-(1,3-thiazol-5-yl)pentyl]phenyl]pentanoic acid (PubChem CID 163653216) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (2S)-2-methyl-5-oxo-5-[3-[5-(1,3-thiazol-5-yl)pentyl]phenyl]pentanoic acid.
| Compound Name | (2S)-2-methyl-5-oxo-5-[3-[5-(1,3-thiazol-5-yl)pentyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 163653216 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2S)-2-methyl-5-oxo-5-[3-[5-(1,3-thiazol-5-yl)pentyl]phenyl]pentanoic acid |
| SMILES | C[C@@H](CCC(=O)c1cccc(CCCCCc2cncs2)c1)C(=O)O |
| InChI | InChI=1S/C20H25NO3S/c1-15(20(23)24)10-11-19(22)17-8-5-7-16(12-17)6-3-2-4-9-18-13-21-14-25-18/h5,7-8,12-15H,2-4,6,9-11H2,1H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | INZMNXKQYSRQBD-HNNXBMFYSA-N |
| XLogP | 4.78 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|