About 1-ethyl-3,5-dimethylpyrazin-2-imine
1-ethyl-3,5-dimethylpyrazin-2-imine (PubChem CID 163653575) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethylpyrazin-2-imine.
Molecular Properties
| Compound Name | 1-ethyl-3,5-dimethylpyrazin-2-imine |
| PubChem CID | 163653575 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-ethyl-3,5-dimethylpyrazin-2-imine |
| SMILES | [H]/N=c1\c(C)nc(C)cn1CC |
| InChI | InChI=1S/C8H13N3/c1-4-11-5-6(2)10-7(3)8(11)9/h5,9H,4H2,1-3H3/b9-8+ |
| InChIKey | IOHHMDDTMHRKQX-CMDGGOBGSA-N |
| XLogP | 1.00 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-3,5-dimethylpyrazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-dimethylpyrazin-2-imine?
The IUPAC name of 1-ethyl-3,5-dimethylpyrazin-2-imine (CID 163653575) is 1-ethyl-3,5-dimethylpyrazin-2-imine.
What is the SMILES notation for 1-ethyl-3,5-dimethylpyrazin-2-imine?
The canonical SMILES for 1-ethyl-3,5-dimethylpyrazin-2-imine is [H]/N=c1\c(C)nc(C)cn1CC.
What is the InChIKey of 1-ethyl-3,5-dimethylpyrazin-2-imine?
The InChIKey is IOHHMDDTMHRKQX-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H13N3/c1-4-11-5-6(2)10-7(3)8(11)9/h5,9H,4H2,1-3H3/b9-8+.
What are the key properties of 1-ethyl-3,5-dimethylpyrazin-2-imine?
1-ethyl-3,5-dimethylpyrazin-2-imine has a molecular weight of 151.21 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dimethylpyrazin-2-imine is sourced from PubChem (CID 163653575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).