About potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide
potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide (PubChem CID 163653698) has the molecular formula C13H11KN2O4S
and a molecular weight of 330.41 g/mol. Its IUPAC name is potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide.
Molecular Properties
| Compound Name | potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide |
| PubChem CID | 163653698 |
| Molecular Formula | C13H11KN2O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide |
| SMILES | O=S(=O)(O)c1nc2c(-c3ccccc3)cccc2[nH]1.[K+].[OH-] |
| InChI | InChI=1S/C13H10N2O3S.K.H2O/c16-19(17,18)13-14-11-8-4-7-10(12(11)15-13)9-5-2-1-3-6-9;;/h1-8H,(H,14,15)(H,16,17,18);;1H2/q;+1;/p-1 |
| InChIKey | IOJXOCNVUFGVDG-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide?
The IUPAC name of potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide (CID 163653698) is potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide.
What is the SMILES notation for potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide?
The canonical SMILES for potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide is O=S(=O)(O)c1nc2c(-c3ccccc3)cccc2[nH]1.[K+].[OH-].
What is the InChIKey of potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide?
The InChIKey is IOJXOCNVUFGVDG-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H10N2O3S.K.H2O/c16-19(17,18)13-14-11-8-4-7-10(12(11)15-13)9-5-2-1-3-6-9;;/h1-8H,(H,14,15)(H,16,17,18);;1H2/q;+1;/p-1.
What are the key properties of potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide?
potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide has a molecular weight of 330.41 g/mol, XLogP of -0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;4-phenyl-1H-benzimidazole-2-sulfonic acid;hydroxide is sourced from PubChem (CID 163653698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).