About (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene
(3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene (PubChem CID 163653956) has the molecular formula C8H12
and a molecular weight of 108.18 g/mol. Its IUPAC name is (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene.
Molecular Properties
| Compound Name | (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene |
| PubChem CID | 163653956 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene |
| SMILES | CC1C2C=C2C[C@H]1C |
| InChI | InChI=1S/C8H12/c1-5-3-7-4-8(7)6(5)2/h4-6,8H,3H2,1-2H3/t5-,6?,8?/m1/s1 |
| InChIKey | IOOXMGDEWBYEPN-SDUJUNFKSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene?
The IUPAC name of (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene (CID 163653956) is (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene.
What is the SMILES notation for (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene?
The canonical SMILES for (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene is CC1C2C=C2C[C@H]1C.
What is the InChIKey of (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene?
The InChIKey is IOOXMGDEWBYEPN-SDUJUNFKSA-N. The full InChI is InChI=1S/C8H12/c1-5-3-7-4-8(7)6(5)2/h4-6,8H,3H2,1-2H3/t5-,6?,8?/m1/s1.
What are the key properties of (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene?
(3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene has a molecular weight of 108.18 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,4-dimethylbicyclo[3.1.0]hex-1(6)-ene is sourced from PubChem (CID 163653956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).