C17H22BN3O4S — CID 163654570
6-(2-methylsulfinylethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 163654570) has the molecular formula C17H22BN3O4S and a molecular weight of 375.26 g/mol. Its IUPAC name is 6-(2-methylsulfinylethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-(2-methylsulfinylethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 163654570 |
| Molecular Formula | C17H22BN3O4S |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 6-(2-methylsulfinylethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CS(=O)CCOc1cc(B2OC(C)(C)C(C)(C)O2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C17H22BN3O4S/c1-16(2)17(3,4)25-18(24-16)14-8-13(23-6-7-26(5)22)11-21-15(14)12(9-19)10-20-21/h8,10-11H,6-7H2,1-5H3 |
| InChIKey | IPBGGUJQBRGTSV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 85.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|