C19H34INO2 — CID 163654611
(1S,3S,4S)-4-[1-(aminomethyl)-5,5-dimethyl-3,4,6,7-tetrahydro-2H-cyclopenta[b]iodinin-2-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol (PubChem CID 163654611) has the molecular formula C19H34INO2 and a molecular weight of 435.39 g/mol. Its IUPAC name is (1S,3S,4S)-4-[1-(aminomethyl)-5,5-dimethyl-3,4,6,7-tetrahydro-2H-cyclopenta[b]iodinin-2-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol.
| Compound Name | (1S,3S,4S)-4-[1-(aminomethyl)-5,5-dimethyl-3,4,6,7-tetrahydro-2H-cyclopenta[b]iodinin-2-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 163654611 |
| Molecular Formula | C19H34INO2 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (1S,3S,4S)-4-[1-(aminomethyl)-5,5-dimethyl-3,4,6,7-tetrahydro-2H-cyclopenta[b]iodinin-2-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol |
| SMILES | CC1(C)CCC2=C1CCC([C@@]1(C)CC[C@H](O)C[C@@H]1CO)I2CN |
| InChI | InChI=1S/C19H34INO2/c1-18(2)8-7-16-15(18)4-5-17(20(16)12-21)19(3)9-6-14(23)10-13(19)11-22/h13-14,17,22-23H,4-12,21H2,1-3H3/t13-,14+,17?,19+/m1/s1 |
| InChIKey | IPCGBMPQFALAHV-PWEXSUBRSA-N |
| XLogP | 3.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|