C13H4BrFIN3S3 — CID 163654946
7-bromo-6-fluoro-4-[5-(5-iodothiophen-2-yl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine (PubChem CID 163654946) has the molecular formula C13H4BrFIN3S3 and a molecular weight of 524.20 g/mol. Its IUPAC name is 7-bromo-6-fluoro-4-[5-(5-iodothiophen-2-yl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine.
| Compound Name | 7-bromo-6-fluoro-4-[5-(5-iodothiophen-2-yl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 163654946 |
| Molecular Formula | C13H4BrFIN3S3 |
| Molecular Weight | 524.20 g/mol |
| Exact Mass | 522.78 |
| IUPAC Name | 7-bromo-6-fluoro-4-[5-(5-iodothiophen-2-yl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine |
| SMILES | Fc1nc(-c2ccc(-c3ccc(I)s3)s2)c2nsnc2c1Br |
| InChI | InChI=1S/C13H4BrFIN3S3/c14-9-11-12(19-22-18-11)10(17-13(9)15)7-2-1-5(20-7)6-3-4-8(16)21-6/h1-4H |
| InChIKey | IPKCPFBFCZIRBA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.20 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|