C11H19NO — CID 163655261
(7S)-7-ethenyl-5-[(1R)-1-methoxyethyl]-4-azaspiro[2.4]heptane (PubChem CID 163655261) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (7S)-7-ethenyl-5-[(1R)-1-methoxyethyl]-4-azaspiro[2.4]heptane.
| Compound Name | (7S)-7-ethenyl-5-[(1R)-1-methoxyethyl]-4-azaspiro[2.4]heptane |
|---|---|
| PubChem CID | 163655261 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (7S)-7-ethenyl-5-[(1R)-1-methoxyethyl]-4-azaspiro[2.4]heptane |
| SMILES | C=C[C@@H]1CC([C@@H](C)OC)NC12CC2 |
| InChI | InChI=1S/C11H19NO/c1-4-9-7-10(8(2)13-3)12-11(9)5-6-11/h4,8-10,12H,1,5-7H2,2-3H3/t8-,9-,10?/m1/s1 |
| InChIKey | IPRAXJABJSEASL-MGRQHWMJSA-N |
| XLogP | 1.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|