C13H10N4O4 — CID 163655579
10-(2,6-dioxopiperidin-3-yl)-2,5,10-triazabicyclo[5.4.0]undeca-1,3,4,6-tetraene-9,11-dione (PubChem CID 163655579) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is 10-(2,6-dioxopiperidin-3-yl)-2,5,10-triazabicyclo[5.4.0]undeca-1,3,4,6-tetraene-9,11-dione.
| Compound Name | 10-(2,6-dioxopiperidin-3-yl)-2,5,10-triazabicyclo[5.4.0]undeca-1,3,4,6-tetraene-9,11-dione |
|---|---|
| PubChem CID | 163655579 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 10-(2,6-dioxopiperidin-3-yl)-2,5,10-triazabicyclo[5.4.0]undeca-1,3,4,6-tetraene-9,11-dione |
| SMILES | O=C1CCC(N2C(=O)CC3=CN=C=CN=C3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10N4O4/c18-9-2-1-8(12(20)16-9)17-10(19)5-7-6-14-3-4-15-11(7)13(17)21/h4,6,8H,1-2,5H2,(H,16,18,20) |
| InChIKey | IPYBBQSGMFNRLN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|