About N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine
N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine (PubChem CID 163655813) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine |
| PubChem CID | 163655813 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine |
| SMILES | CC(NC1C=CC=CC1)[C@H]1CN(C)CO1 |
| InChI | InChI=1S/C12H20N2O/c1-10(12-8-14(2)9-15-12)13-11-6-4-3-5-7-11/h3-6,10-13H,7-9H2,1-2H3/t10?,11?,12-/m1/s1 |
| InChIKey | IQCOOIPPTBIXMT-HTAVTVPLSA-N |
| XLogP | 1.14 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine?
The IUPAC name of N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine (CID 163655813) is N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine?
The canonical SMILES for N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine is CC(NC1C=CC=CC1)[C@H]1CN(C)CO1.
What is the InChIKey of N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine?
The InChIKey is IQCOOIPPTBIXMT-HTAVTVPLSA-N. The full InChI is InChI=1S/C12H20N2O/c1-10(12-8-14(2)9-15-12)13-11-6-4-3-5-7-11/h3-6,10-13H,7-9H2,1-2H3/t10?,11?,12-/m1/s1.
What are the key properties of N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine?
N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine has a molecular weight of 208.31 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(5R)-3-methyl-1,3-oxazolidin-5-yl]ethyl]cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 163655813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).