About 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one
2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one (PubChem CID 163655884) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one.
Molecular Properties
| Compound Name | 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one |
| PubChem CID | 163655884 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one |
| SMILES | C=C1C=CCN(C)NC1=O |
| InChI | InChI=1S/C7H10N2O/c1-6-4-3-5-9(2)8-7(6)10/h3-4H,1,5H2,2H3,(H,8,10) |
| InChIKey | IQEDMYKQFJNGME-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one?
The IUPAC name of 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one (CID 163655884) is 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one.
What is the SMILES notation for 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one?
The canonical SMILES for 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one is C=C1C=CCN(C)NC1=O.
What is the InChIKey of 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one?
The InChIKey is IQEDMYKQFJNGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-6-4-3-5-9(2)8-7(6)10/h3-4H,1,5H2,2H3,(H,8,10).
What are the key properties of 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one?
2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one has a molecular weight of 138.17 g/mol, XLogP of 0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-methylidene-1,3-dihydrodiazepin-7-one is sourced from PubChem (CID 163655884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).